
Catalog Number	AR00E12G
Chemical Name	2-Naphthylammonium acetate
CAS Number	553-00-4
Molecular Formula	C12H13NO2
Molecular Weight	203.2371
SMILES	[NH3+]c1ccc2c(c1)cccc2.[O-]C(=O)C

2-Naphthylammonium acetate is a versatile chemical compound commonly utilized in various chemical synthesis processes. This compound plays a crucial role in organic chemistry as a key intermediate in the preparation of diverse organic compounds. Due to its unique structure and properties, 2-Naphthylammonium acetate is frequently employed in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. Its ability to undergo selective reactions and form stable intermediates makes it a valuable building block in the development of novel molecules with desirable properties. In addition, 2-Naphthylammonium acetate is known for its high reactivity and compatibility with a wide range of organic reagents, enabling chemists to efficiently access complex molecular structures in a controlled manner. This compound's significance in chemical synthesis extends to academic research, industrial applications, and pharmaceutical development, highlighting its importance in advancing the field of organic chemistry.