
Catalog Number	AR00IAJL
Chemical Name	1，4-Diiodo-2-methoxy-5-nitrobenzene
CAS Number	55215-55-9
Molecular Formula	C7H5I2NO3
Molecular Weight	404.9284
MDL Number	MFCD28792695
SMILES	COc1cc(I)c(cc1I)[N+](=O)[O-]

1,4-Diiodo-2-methoxy-5-nitrobenzene is a powerful and versatile compound widely used in chemical synthesis. In organic chemistry, it serves as a key building block for the creation of various complex molecules and pharmaceuticals. Due to its unique structure and reactivity, this compound plays a crucial role in the development of new materials and substances with advanced properties. With its ability to undergo diverse chemical reactions, 1,4-Diiodo-2-methoxy-5-nitrobenzene enables chemists to access a wide range of functionalized products, making it an indispensable tool in modern synthetic chemistry.