
Catalog Number	AR00DHFT
Chemical Name	lupanine
CAS Number	550-90-3
Molecular Formula	C15H24N2O
Molecular Weight	248.3639
MDL Number	MFCD00870094
SMILES	O=C1CCC[C@H]2N1C[C@@H]1C[C@H]2CN2[C@H]1CCCC2

Lupanine, a naturally occurring compound found in various plant species, is utilized in chemical synthesis as a versatile building block for the production of a wide range of complex molecules. Its unique structural features make it an ideal starting material for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. In particular, Lupanine's functional groups, such as its amine and alkene moieties, can undergo a variety of chemical reactions, including hydrogenation, acylation, and cyclization, to yield diverse products with valuable properties. With its importance in the field of organic chemistry, Lupanine plays a crucial role in the development of novel compounds for various industrial applications.