
Catalog Number	AR00DHPC
Chemical Name	roseoside
CAS Number	54835-70-0
Molecular Formula	C19H30O8
Molecular Weight	386.4367
MDL Number	MFCD17214862
SMILES	OC[C@H]1O[C@@H](O[C@@H](/C=C/[C@@]2(O)C(=CC(=O)CC2(C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Roseoside is a versatile compound widely utilized in chemical synthesis for its unique properties and diverse applications. With its ability to act as a glycosyl donor, Roseoside plays a crucial role in the synthesis of various natural products and pharmaceuticals. It serves as a key building block in the creation of complex molecules by facilitating glycosylation reactions, which are essential in the formation of glycosidic bonds. These bonds are vital in the development of bioactive compounds, making Roseoside a valuable tool in medicinal chemistry and drug discovery. Additionally, Roseoside is employed in the synthesis of flavor compounds, fragrances, and other specialty chemicals, showcasing its significance in the field of organic synthesis. Its adaptable nature and synthetic utility make Roseoside a prized component in the realm of chemical synthesis, paving the way for innovative research and product development.