
Catalog Number	AR00DKWH
Chemical Name	7-(DiethylaMino)couMarin-3-carbaldehyde
CAS Number	54711-39-6
Molecular Formula	C14H15NO3
Molecular Weight	245.2738
MDL Number	MFCD00438856
SMILES	CCN(c1ccc2c(c1)oc(=O)cc2C=O)CC

7-(Diethylamino)-2-oxo-2H-1-benzopyran-4-carboxaldehyde is a versatile compound widely utilized in chemical synthesis, particularly in the field of organic chemistry. Its unique molecular structure makes it a valuable building block for the creation of various complex molecules and functional materials. This compound can serve as a key intermediate in the synthesis of heterocyclic compounds, which are essential in the development of pharmaceuticals, agrochemicals, and advanced materials. By incorporating 7-(Diethylamino)-2-oxo-2H-1-benzopyran-4-carboxaldehyde into reaction schemes, chemists can access a diverse array of chemical transformations, enabling the construction of molecules with tailored properties and functionalities.Furthermore, this compound's presence of both an aldehyde and a ketone group provides opportunities for selective functionalization and modification, allowing for precise control over the chemical reactivity and regioselectivity of reactions. Its ability to participate in various types of chemical reactions, such as condensation, reduction, and cyclization reactions, makes it a valuable tool in the hands of synthetic chemists seeking to design novel compounds with specific characteristics and applications.