
Catalog Number	AR00DGNE
Chemical Name	4-Thujanol
CAS Number	546-79-2
Molecular Formula	C10H18O
Molecular Weight	154.2493
MDL Number	MFCD13185232
SMILES	CC([C@]12CCC([C@@H]2C1)(C)O)C

Sabinene hydrate, a cyclic monoterpene alcohol, is widely utilized in chemical synthesis for its versatile applications. This compound plays a significant role in the fragrance industry, particularly in the production of perfumes and fragrances. Its pleasant and fresh aroma makes it a popular choice for creating various scents, adding a touch of citrusy and woody notes.In addition to its use in the fragrance industry, sabinene hydrate also finds applications in the field of organic chemistry. Its unique chemical structure makes it a valuable building block for the synthesis of complex organic compounds. Chemists often use sabinene hydrate as a starting material to create a variety of pharmaceuticals, agrochemicals, and fine chemicals.Furthermore, sabinene hydrate is known for its antimicrobial properties, making it a key ingredient in the formulation of disinfectants and antimicrobial agents. Its ability to inhibit the growth of bacteria and fungi has led to its use in various healthcare products and cleaning solutions.Overall, sabinene hydrate's diverse applications in chemical synthesis make it a valuable compound in various industries, ranging from fragrance and pharmaceuticals to healthcare and agriculture.