
Catalog Number	AR00DHMO
Chemical Name	Glutina-5-ene-3β-ol
CAS Number	545-24-4
Molecular Formula	C30H50O
Molecular Weight	426.7174
MDL Number	MFCD20260391
SMILES	O[C@H]1CC[C@@H]2C(=CC[C@H]3[C@@]2(C)CC[C@@]2([C@]3(C)CC[C@@]3([C@H]2CC(C)(C)CC3)C)C)C1(C)C

5-Glutinen-3-Ol, also known as glutinenol, is a versatile compound that plays a crucial role in chemical synthesis, particularly in the field of organic chemistry. This compound is widely utilized as a key building block in the synthesis of various complex molecules due to its unique chemical structure and reactivity.In chemical synthesis, 5-Glutinen-3-Ol serves as a valuable intermediate for the preparation of a wide range of organic compounds. Its hydroxyl group makes it a versatile starting material for the synthesis of esters, ethers, and other functionalized derivatives. Additionally, the presence of a double bond in the glutinenol molecule allows for further structural modifications through various reactions such as hydrogenation, oxidation, and reduction.Furthermore, the reactivity of 5-Glutinen-3-Ol towards different reagents and catalysts makes it an essential component in the development of new synthetic methodologies. Chemists can exploit the unique properties of this compound to create complex organic molecules with specific functionalities and stereochemistry, enabling the synthesis of pharmaceuticals, agrochemicals, and materials with tailored properties.Overall, 5-Glutinen-3-Ol is a valuable tool in chemical synthesis, providing chemists with a versatile building block for the creation of diverse organic compounds with potential applications in various industries.