
Catalog Number	AR00DJKS
Chemical Name	1,2,3,4-Tetrahydro-2,4-dioxopyrrolo[1,2-a]-1,3,5-triazine-7-carboxylic acid
CAS Number	54449-90-0
Molecular Formula	C7H5N3O4
Molecular Weight	195.1323
MDL Number	MFCD20642498
SMILES	OC(=O)c1cn2c(c1)[nH]c(=O)[nH]c2=O

The compound 1,2,3,4-Tetrahydro-2,4-dioxopyrrolo[1,2-a]-1,3,5-triazine-7-carboxylic acid is a versatile building block in chemical synthesis. It serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and functional materials. This compound is commonly employed as a precursor in the synthesis of heterocyclic compounds with diverse biological activities. Its unique structural features make it a valuable starting material for the preparation of antiviral, antibacterial, and antitumor agents. In addition, 1,2,3,4-Tetrahydro-2,4-dioxopyrrolo[1,2-a]-1,3,5-triazine-7-carboxylic acid is utilized in the development of novel materials with specific physicochemical properties. Its incorporation into polymer chains or coordination complexes can lead to the enhancement of material strength, thermal stability, or electronic properties. Overall, the strategic utilization of this compound in chemical synthesis allows for the creation of diverse molecules with potential applications in the fields of medicine, agriculture, and materials science.