
Catalog Number	AR003GRI
Chemical Name	2,6-DIBROMOPHENOLINDOPHENOL SODIUM SALT
CAS Number	5415-23-6
Molecular Formula	C12H7Br2NNaO2
Molecular Weight	379.9872
MDL Number	MFCD00058958
SMILES	BrC1=C/C(=N/c2ccc(cc2)O)/C=C(C1=O)Br.[Na]

The Sodium 4-((3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)amino)phenolate compound plays a crucial role in chemical synthesis as a versatile reagent. Specifically, it is employed as a key component in the production of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and chemical properties make it an ideal precursor for constructing complex aromatic compounds with important biological activities. In addition, Sodium 4-((3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)amino)phenolate is widely utilized in the development of novel dyes, pigments, and specialty chemicals, highlighting its significance in enhancing the synthesis of valuable organic compounds.