
Catalog Number	AR00DHGT
Chemical Name	15-HYDROXYDEHYDROABIETICACID
CAS Number	54113-95-0
Molecular Formula	C20H28O3
Molecular Weight	316.4345
MDL Number	MFCD17214821
SMILES	OC(=O)[C@]1(C)CCC[C@]2([C@H]1CCc1c2ccc(c1)C(O)(C)C)C

15-Hydroxydehydroabietic acid, a naturally occurring compound derived from pine tree resin, plays a crucial role in chemical synthesis as a versatile building block. With its unique molecular structure and reactivity, this compound serves as a valuable precursor for the production of various pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, 15-Hydroxydehydroabietic acid can undergo a range of transformations to yield diverse intermediate compounds with modified functionalities. Its hydroxyl group provides an important site for derivatization, allowing for the introduction of different functional groups through various synthetic routes. This enables chemists to tailor the properties of the final products to meet specific application requirements.Furthermore, the presence of a conjugated diene system in 15-Hydroxydehydroabietic acid offers opportunities for further chemical modifications, such as cycloaddition reactions or oxidative transformations, leading to the creation of complex molecular structures. These structural modifications can enhance the bioactivity, stability, or solubility of the resulting compounds, making them valuable in drug discovery and development processes.Overall, the application of 15-Hydroxydehydroabietic acid in chemical synthesis showcases its potential as an essential building block for the design and synthesis of novel compounds with diverse applications across industries.