
Catalog Number	AR00E4PT
Chemical Name	2-nitro-p-toluenesulphonyl chloride
CAS Number	54090-41-4
Molecular Formula	C7H6ClNO4S
Molecular Weight	235.6448
MDL Number	MFCD01365819
SMILES	Cc1ccc(c(c1)[N+](=O)[O-])S(=O)(=O)Cl

4-Methyl-2-nitrobenzene-1-sulfonyl chloride, also known as sulfonyl chloride, is a powerful chemical reagent commonly used in organic synthesis. This compound is valued for its ability to introduce the sulfonyl group into organic molecules, thereby providing a versatile platform for various reactions and functional group manipulations. In chemical synthesis, 4-Methyl-2-nitrobenzene-1-sulfonyl chloride serves as a key building block in the preparation of sulfonamides, sulfonylureas, and other pharmaceutical intermediates. Additionally, its reactivity allows for the efficient formation of C-S, C-N, and C-O bonds, enabling the synthesis of diverse compounds with important biological activities.