
Catalog Number	AR01DOHC
Chemical Name	3H-Indolium,2-[[(4-methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-, methylsulfate
CAS Number	54060-92-3
Molecular Formula	C20H24N3O
Molecular Weight	322.4241
MDL Number	MFCD00071875
SMILES	COc1ccc(cc1)N(/N=C/C1=[N+](C)c2c(C1(C)C)cccc2)C

Basic Yellow 28 is a versatile dye that finds a wide range of applications in chemical synthesis. Due to its strong affinity for binding to various molecules, Basic Yellow 28 is commonly used as a staining agent in organic chemistry laboratories. Its vibrant yellow color makes it ideal for visualizing and tracking reactions, particularly in thin-layer chromatography and column chromatography techniques. Additionally, Basic Yellow 28 can act as a visual indicator for the presence of certain functional groups or chemical species in a reaction mixture, aiding chemists in their analysis and purification processes. Furthermore, this dye can also be employed in the synthesis of fluorescent compounds, where its optical properties enhance the detection and characterization of specific molecules. In summary, Basic Yellow 28 plays a crucial role in chemical synthesis by facilitating visualization, analysis, and identification of compounds during various stages of experimentation.