
Catalog Number	AR00IABZ
Chemical Name	4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid,3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]- (2S,5R,6R)-, compd. with2-(diethylamino)ethyl 4-aminobenzoate (1:1)OTHER CA INDEX NAMES:Benzoic acid, 4-amino-, 2-(diethylamino)ethyl ester,mono[(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2
CAS Number	54-35-3
Molecular Formula	C29H38N4O6S
Molecular Weight	570.7002
MDL Number	MFCD00079285
SMILES	O=C(Cc1ccccc1)NC1C(=O)N2C1SC(C2C(=O)O)(C)C.CCN(CCOC(=O)c1ccc(cc1)N)CC

Penicillin G procaine, a derivative of penicillin, is commonly utilized as a powerful antibiotic in medical applications. Beyond its antibiotic properties, this compound also finds significant utility in chemical synthesis processes. In the realm of organic chemistry, Penicillin G procaine serves as a valuable building block for the synthesis of novel compounds and pharmaceuticals. Its unique structure and functional groups enable chemists to modify and utilize it in the creation of structurally diverse molecules with various pharmacological activities. Additionally, Penicillin G procaine can be incorporated as a key intermediate in the synthesis of more complex compounds, showcasing its versatility and importance in the field of chemical synthesis.