
Catalog Number	AR00DFHX
Chemical Name	DICAPRIN
CAS Number	53988-07-1
Molecular Formula	C23H44O5
Molecular Weight	400.5925
MDL Number	MFCD00036706
SMILES	CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)O

The (3-decanoyloxy-2-hydroxy-propyl) decanoate compound plays a crucial role in chemical synthesis as a versatile reagent with a range of applications. In organic chemistry, this compound is commonly used as a precursor in the synthesis of various esters, ethers, and organic acids. Its unique structure provides opportunities for functional group transformations and selective reactions, making it a valuable tool for preparing complex molecules. Additionally, (3-decanoyloxy-2-hydroxy-propyl) decanoate is often employed in the production of pharmaceutical compounds, where its properties can be harnessed to introduce specific structural motifs or enhance the bioavailability of active ingredients. This compound's utility extends to material science as well, serving as a building block for the creation of specialized polymers and surfactants. With its diverse applications and reactivity, (3-decanoyloxy-2-hydroxy-propyl) decanoate is a key component in the toolkit of synthetic chemists seeking to design novel molecules and materials.