
Catalog Number	AR01ECD5
Chemical Name	Heptakis(6-azido-6-deoxy)-β-cyclodextrin
CAS Number	53958-47-7
Molecular Formula	C42H63N21O28
Molecular Weight	1310.0735
SMILES	[N-]=[N+]=NC[C@H]1O[C@@H]2O[C@@H]3[C@@H](CN=[N+]=[N-])O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]3[C@@H](CN=[N+]=[N-])O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]3[C@@H](CN=[N+]=[N-])O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]3[C@H](O[C@H](O[C@@H]4[C@H](O[C@H](O[C@@H]5[C@H](O[C@H](O[C@H]1[C@@H]([C@H]2O)O)[C@H](O)[C@H]5O)CN=[N+]=[N-])[C@H](O)[C@H]4O)CN=[N+]=[N-])[C@H](O)[C@H]3O)CN=[N+]=[N-]

Heptakis(6-azido-6-deoxy)-β-cyclodextrin is a specialized compound that finds valuable utility in chemical synthesis processes. This molecule serves as a versatile intermediate in various synthetic pathways due to its unique structure and reactivity. In chemical synthesis, Heptakis(6-azido-6-deoxy)-β-cyclodextrin can act as a crosslinking agent in the formation of complex macromolecular structures. Additionally, it can be employed as a protective group for specific functional groups, allowing for selective reactions to take place without interference. Furthermore, this compound is utilized in the preparation of novel materials with tailored properties, making it a valuable tool for researchers and chemists working in the field of chemical synthesis.