
Catalog Number	AR00E4F6
Chemical Name	s-Indacene-1,3,5,7(2H,6H)-tetrone
CAS Number	53910-13-7
Molecular Formula	C12H6O4
Molecular Weight	214.17364000000003
MDL Number	MFCD01956452
SMILES	O=C1CC(=O)c2c1cc1C(=O)CC(=O)c1c2

$s-Indacene-1,3,5,7(2H,6H)-tetrone$ is a versatile compound that finds valuable applications in chemical synthesis. As a powerful electron acceptor, it can participate in a wide range of reactions to form various functionalized products. In organic synthesis, $s-Indacene-1,3,5,7(2H,6H)-tetrone$ serves as a key building block for the construction of complex molecular structures. Its unique structure and reactivity make it particularly useful in the formation of conjugated systems and heterocyclic compounds. The presence of multiple carbonyl groups in $s-Indacene-1,3,5,7(2H,6H)-tetrone$ offers opportunities for selective functionalization, enabling the synthesis of diverse derivatives with tailored properties. Chemists leverage the properties of this compound to design novel materials, explore new reaction pathways, and advance the frontier of synthetic chemistry.