
Catalog Number	AR00IAAK
Chemical Name	2H-Benzimidazol-2-one, 1,3-dihydro-1-methyl-3-(4-piperidinyl)-
CAS Number	53786-10-0
Molecular Formula	C13H17N3O
Molecular Weight	231.2936
MDL Number	MFCD02179381
SMILES	Cn1c(=O)n(c2c1cccc2)C1CCNCC1

1-Methyl-3-(piperidin-4-yl)-1,3-dihydro-2H-benzimidazol-2-one is a versatile compound with significant applications in chemical synthesis. Its unique molecular structure enables it to serve as a key building block in the creation of various organic molecules through a series of well-defined chemical reactions. Specifically, this compound can be utilized as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. By incorporating 1-Methyl-3-(piperidin-4-yl)-1,3-dihydro-2H-benzimidazol-2-one into synthetic pathways, chemists can efficiently access structurally complex compounds with desired biological or commercial properties. Additionally, the presence of the piperidine and benzimidazole moieties in the molecule provides opportunities for further functionalization, allowing for the synthesis of diverse molecular architectures with tailored properties. This compound's role in chemical synthesis underscores its importance as a valuable tool for the development of novel materials and biologically active compounds.