
Catalog Number	AR01HZY8
Chemical Name	2-Propenoic acid, 3-nitro-, 1,1-dimethylethyl ester, (2E)-
CAS Number	537005-95-1
Molecular Formula	C7H11NO4
Molecular Weight	173.1665
MDL Number	MFCD34474985
SMILES	O=C(OC(C)(C)C)/C=C/[N+](=O)[O-]

2-Propenoic acid, 3-nitro-, 1,1-dimethylethyl ester, (2E)- is a key compound commonly utilized in chemical synthesis for its versatile applications. This compound is predominantly employed in organic synthesis reactions to introduce the 3-nitropropyl ester group into various target molecules. Its unique structure and reactivity make it a valuable building block in the preparation of fine chemicals and pharmaceutical intermediates. Additionally, this compound serves as a valuable reagent in the production of polymers with specific functionalities, demonstrating its significance in the field of materials science.