
Catalog Number	AR00D94P
Chemical Name	2-Amino-3-nitro-5-trifluoromethylpyridine
CAS Number	53359-69-6
Molecular Formula	C6H4F3N3O2
Molecular Weight	207.1101
MDL Number	MFCD01571316
SMILES	[O-][N+](=O)c1cc(cnc1N)C(F)(F)F

3-nitro-5-(trifluoroMethyl)pyridin-2-aMine is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. This compound can serve as a valuable building block in the creation of various organic molecules and pharmaceuticals. One key application of 3-nitro-5-(trifluoroMethyl)pyridin-2-aMine is its role as a precursor in the synthesis of heterocyclic compounds. By undergoing various chemical transformations, this compound can be used to introduce functional groups and structural motifs into the target molecules, allowing for the creation of complex organic frameworks.Additionally, 3-nitro-5-(trifluoroMethyl)pyridin-2-aMine can also participate in traditional and novel synthetic methodologies such as cross-coupling reactions, nucleophilic substitutions, and reductive transformations. Its trifluoromethyl group offers unique opportunities for further functionalization and diversification of the resulting products, making it a valuable tool in synthetic chemistry.Overall, the versatile nature of 3-nitro-5-(trifluoroMethyl)pyridin-2-aMine makes it an essential component in the toolkit of organic chemists, enabling the efficient and strategic synthesis of diverse chemical compounds.