
Catalog Number	AR003V7P
Chemical Name	TERT-BUTANOL-D10
CAS Number	53001-22-2
Molecular Formula	C4D10O
Molecular Weight	84.1832
MDL Number	MFCD00064244
SMILES	O([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H]

Tert-Butanol-d10, a deuterated derivative of tert-butanol, serves as a valuable tool in chemical synthesis due to its unique properties and applications. This isotopically labeled compound is commonly used as a solvent, particularly in NMR spectroscopy, as it helps improve the resolving power and sensitivity of analyses by providing distinct peaks for easy detection and interpretation. In addition, tert-Butanol-d10 is utilized as a reference standard in mass spectrometry and other analytical techniques, facilitating accurate quantification and identification of compounds in complex mixtures. Furthermore, its high level of deuteration enhances stability and solubility in various reaction conditions, making it an ideal choice for studies investigating reaction mechanisms, kinetics, and isotopic labeling experiments. Its versatility and reliability make tert-Butanol-d10 an essential component in the toolkit of chemists and researchers across diverse fields of chemistry.