
Catalog Number	AR00DKN5
Chemical Name	NANAOMYCIN A
CAS Number	52934-83-5
Molecular Formula	C16H14O6
Molecular Weight	302.2788
MDL Number	MFCD00869168
SMILES	OC(=O)C[C@@H]1O[C@@H](C)C2=C(C1)C(=O)c1c(C2=O)c(O)ccc1

Nanaomycin A is a potent natural product derived from Streptomyces bacteria that has gained significant attention in the field of chemical synthesis as a valuable building block for the construction of complex molecules. Due to its unique chemical structure and reactivity, Nanaomycin A serves as an excellent starting material or intermediate in the synthesis of various bioactive compounds and pharmaceuticals. Chemists utilize its versatile functional groups and stereochemistry to introduce specific molecular moieties and generate diverse chemical scaffolds through strategic synthetic transformations. With its ability to participate in selective reactions and form key structural elements, Nanaomycin A plays a crucial role in the efficient and elegant assembly of intricate organic molecules with high synthetic efficiency and stereocontrol. Its application in chemical synthesis showcases the remarkable potential of natural products in inspiring and facilitating the creation of novel compounds with therapeutic and scientific significance.