
Catalog Number	AR01E94U
Chemical Name	Tremuloidin
CAS Number	529-66-8
Molecular Formula	C20H22O8
Molecular Weight	390.3839
MDL Number	MFCD00238698
SMILES	OC[C@H]1O[C@@H](Oc2ccccc2CO)[C@@H]([C@H]([C@@H]1O)O)OC(=O)c1ccccc1

Tremuloidin is a valuable compound used in chemical synthesis, particularly in the field of organic chemistry. With its unique structure and reactivity, Tremuloidin serves as a versatile building block for creating complex molecules and compounds. Chemists utilize Tremuloidin as a key reagent in various reactions, such as cross-coupling, functional group transformation, and heterocycle synthesis. Its ability to undergo diverse chemical transformations makes Tremuloidin an indispensable tool for the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Furthermore, Tremuloidin plays a crucial role in the development of new synthetic methodologies, paving the way for innovative and efficient approaches in organic synthesis.