
Catalog Number	AR00E3KC
Chemical Name	methyl N,N,N-trimethyl-4-[(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-ylidene)methyl]anilinium sulphate
CAS Number	52793-97-2
Molecular Formula	C21H31NO5S
Molecular Weight	409.5395
MDL Number	MFCD21608918
SMILES	O=C1C(=Cc2ccc(cc2)[N+](C)(C)C)[C@H]2C([C@]1(C)CC2)(C)C.COS(=O)(=O)[O-]

Camphor benzalkonium methosulfate is a versatile compound widely employed in chemical synthesis as a catalyst. This compound plays a crucial role in promoting various chemical reactions by facilitating the interaction between different reactants. Its unique chemical properties make it an essential component in the synthesis of organic compounds, pharmaceuticals, and specialty materials. With its ability to increase reaction rates and control selectivity, camphor benzalkonium methosulfate is a key tool for chemists in achieving desired product outcomes efficiently and effectively.