
Catalog Number	AR00IA2P
Chemical Name	Benzoxazole,2-[4-[2-[4-(2-benzoxazolyl)phenyl]ethenyl]phenyl]-5-methyl-
CAS Number	5242-49-9
Molecular Formula	C29H20N2O2
Molecular Weight	428.4813
MDL Number	MFCD00328411
SMILES	Cc1ccc2c(c1)nc(o2)c1ccc(cc1)C=Cc1ccc(cc1)c1nc2c(o1)cccc2

2-(4-(4-(Benzo[d]oxazol-2-yl)styryl)phenyl)-5-methylbenzo[d]oxazole, commonly referred to as $name$, is a versatile compound used in chemical synthesis for a variety of applications. In organic chemistry, this compound serves as a valuable building block for the synthesis of complex molecules due to its unique structural features. By incorporating $name$ into synthetic routes, chemists can access novel compounds with potentially useful properties.One key application of 2-(4-(4-(Benzo[d]oxazol-2-yl)styryl)phenyl)-5-methylbenzo[d]oxazole in chemical synthesis is in the development of fluorescent dyes. The presence of the benzo[d]oxazole and styryl moieties in the molecule imparts strong fluorescent properties, making it a desirable candidate for designing fluorescent probes for various biological and analytical applications. Additionally, the benzoxazole core of $name$ can act as a fluorophore in molecular labeling studies, allowing for visualization and tracking of specific molecules in biological systems.Furthermore, the unique structure of 2-(4-(4-(Benzo[d]oxazol-2-yl)styryl)phenyl)-5-methylbenzo[d]oxazole offers opportunities for the synthesis of materials with optoelectronic properties. By incorporating this compound into conjugated polymers or organic semiconductor materials, researchers can develop advanced materials for applications such as organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and sensors.Overall, the versatility of 2-(4-(4-(Benzo[d]oxazol-2-yl)styryl)phenyl)-5-methylbenzo[d]oxazole in chemical synthesis makes it a valuable component for designing novel molecules with diverse functionalities for a range of scientific and technological applications.