
Catalog Number	AR00DEHU
Chemical Name	S-(hydrogen malonyl)coenzyme A
CAS Number	524-14-1
Molecular Formula	C24H38N7O19P3S
Molecular Weight	853.5803
MDL Number	MFCD00870167
SMILES	O=C(NCCSC(=O)CC(=O)O)CCNC(=O)[C@@H](C(COP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1OP(=O)(O)O)O)n1cnc2c1ncnc2N)O)O)(C)C)O

Malonyl CoA is a crucial molecule in chemical synthesis, particularly in the biosynthesis of fatty acids. This substrate plays a central role in the fatty acid synthesis pathway, where it serves as a building block for the elongation of fatty acid chains. By undergoing a series of condensation reactions with acetyl-CoA, Malonyl CoA contributes two-carbon units that are added sequentially to the growing fatty acid chain. This process is catalyzed by the enzyme fatty acid synthase and is essential for the production of various lipid molecules required for cellular structure and energy storage. Additionally, Malonyl CoA is involved in the regulation of fatty acid metabolism and serves as a key player in the intricate network of cellular processes that maintain lipid homeostasis. Through its participation in fatty acid biosynthesis, Malonyl CoA exemplifies its importance as a fundamental molecule in chemical synthesis pathways essential for cellular function and metabolism.