
Catalog Number	AR00DKP5
Chemical Name	flavoglaucin
CAS Number	523-73-9
Molecular Formula	C19H28O3
Molecular Weight	304.4238
MDL Number	MFCD02752342
SMILES	CCCCCCCc1c(O)cc(c(c1C=O)O)CC=C(C)C

2-Heptyl-3,6-dihydroxy-5-(3-methyl-2-buten-1-yl)benzaldehyde, commonly known as $name$, is a versatile compound widely used in chemical synthesis. This specialized chemical plays a key role in the creation of fragrances and flavor compounds due to its unique structure and properties. Specifically, $name$ is utilized as a building block in the synthesis of complex organic molecules that contribute to the aroma and taste profiles of various consumer products. Its ability to serve as a precursor in the formation of intricate chemical structures makes it an essential ingredient in the production of high-quality scents and flavors. Additionally, $name$ is valued for its role in pharmaceutical research and development, where it is employed in the creation of novel drug compounds. In the realm of chemical synthesis, this compound demonstrates remarkable versatility and efficacy, making it a valuable resource for researchers and manufacturers seeking to innovate in the fields of fragrance, flavor, and pharmaceuticals.