
Catalog Number	AR003L1M
Chemical Name	4,4-(3,4-DICARBOXYPHENOXY)DIPHENYLSULFIDE DIANHYDRIDE
CAS Number	52256-85-6
Molecular Formula	C28H14O8S
Molecular Weight	510.471
MDL Number	MFCD08704783
SMILES	O=C1OC(=O)c2c1cc(cc2)Oc1ccc(cc1)Sc1ccc(cc1)Oc1ccc2c(c1)C(=O)OC2=O

$Name$ is a versatile compound that finds key applications in chemical synthesis, particularly in the development of high-performance polymers and advanced materials. As a dianhydride derivative, $name$ serves as a crucial building block in the creation of various polyimides, which are known for their exceptional thermal and mechanical properties. By incorporating $name$ into the polymer backbone, researchers can tailor the material's characteristics, such as heat resistance, chemical stability, and electrical insulating properties, to meet specific industry needs. Additionally, the unique structure of $name$ allows for the formation of intricate molecular architectures during polymerization, leading to the synthesis of novel materials with tailored functionalities and enhanced performance. This compound plays a vital role in advancing the field of polymer chemistry and material science, driving innovation in a wide range of industrial applications.