
Catalog Number	AR00DABR
Chemical Name	2,4-DINITROTOLUENE-5-SULFONIC ACID SODIUM SALT
CAS Number	52146-86-8
Molecular Formula	C7H6N2O7S
Molecular Weight	262.1967
MDL Number	MFCD03411740
SMILES	[O-][N+](=O)c1cc([N+](=O)[O-])c(cc1S(=O)(=O)O)C

2,4-DINITROTOLUENE-5-SULFONIC ACID SODIUM SALT is a powerful chemical reagent commonly utilized in chemical synthesis processes. This compound plays a crucial role as a sulfonating agent in various reactions, where it is employed for the introduction of sulfonic acid functional groups into organic molecules. With its high reactivity, 2,4-DINITROTOLUENE-5-SULFONIC ACID SODIUM SALT facilitates the modification of organic compounds, enabling the synthesis of new materials, pharmaceuticals, and specialty chemicals with enhanced properties. Its application in the chemical industry extends to the production of dyes, pigments, polymers, and other valuable products that rely on the introduction of sulfonate groups for improved solubility, stability, or reactivity. In the hands of skilled chemists, this compound serves as a versatile tool for tailoring molecular structures and developing novel chemical entities for a wide range of industrial and research applications.