
Catalog Number	AR00DEQO
Chemical Name	2,4-dinitro-3H-imidazole
CAS Number	5213-49-0
Molecular Formula	C3H2N4O4
Molecular Weight	158.0724
MDL Number	MFCD00516999
SMILES	[O-][N+](=O)c1[nH]cc(n1)[N+](=O)[O-]
NSC Number	342704

2,5-Dinitro-1H-imidazole is a versatile compound often utilized in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals, explosives, and specialty chemicals. In chemical synthesis, 2,5-Dinitro-1H-imidazole acts as a valuable intermediate, facilitating the construction of complex molecular structures due to its unique reactivity and functional groups. With its ability to undergo various reactions such as nitration, reduction, and substitution, 2,5-Dinitro-1H-imidazole plays a crucial role in the development of advanced materials and fine chemicals. Its versatility and reactivity make it a sought-after component in organic synthesis, enabling the efficient production of a wide range of compounds with diverse applications across industries.