
Catalog Number	AR00DD1X
Chemical Name	Micronomicin
CAS Number	52093-21-7
Molecular Formula	C20H41N5O7
Molecular Weight	463.5688
MDL Number	MFCD00865016
SMILES	CNC[C@@H]1CC[C@H]([C@H](O1)O[C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@H]1OC[C@]([C@@H]([C@H]1O)NC)(C)O)N)N

Michirolmicin is a broad-spectrum antibiotic known for its efficacy against a wide range of bacterial infections. In chemical synthesis, Michirolmicin plays a crucial role as a potent tool for the development of novel drugs and therapeutic agents. Its unique chemical structure allows for selective targeting of bacterial ribosomes, inhibiting protein synthesis and ultimately leading to bacterial cell death.The application of Michirolmicin in chemical synthesis extends beyond its antibiotic properties. Chemists utilize its structure and reactivity to design and synthesize analogs with improved pharmaceutical properties. By modifying specific functional groups or introducing new chemical moieties, researchers can enhance the antibiotic potency, bioavailability, and stability of Michirolmicin derivatives.Furthermore, Michirolmicin serves as a valuable building block in the synthesis of complex natural products and pharmaceutical compounds. Its versatile chemistry enables the formation of key structural motifs and chemical bonds necessary for the creation of bioactive molecules. Through strategic manipulation of its chemical scaffold, chemists can access diverse molecular scaffolds with potential therapeutic applications.Overall, the versatility and unique characteristics of Michirolmicin make it a valuable tool in chemical synthesis, offering opportunities for the development of novel antibiotics and pharmaceutical agents.

Tetrahydropyran-4-carbaldehyde

50675-18-8

$4.00/100mg, $4.00/250mg, $8.00/1g, $35.00/5g, $68.00/10g, $168.00/25g, $521.00/100g,

Product Details

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine hydrochloride

1121057-75-7

$4.00/250mg, $4.00/100mg, $11.00/1g, $45.00/5g, $78.00/10g, $174.00/25g, $321.00/50g, $606.00/100g,

Product Details

3-Bromo-6-nitroindazole

70315-68-3

$5.00/250mg, $12.00/1g, $35.00/5g, $64.00/10g, $144.00/25g, $277.00/50g, $520.00/100g,

Product Details

Benzenepropanoic acid,3-bromo-b-oxo-, ethyl ester

21575-91-7

$4.00/250mg, $9.00/1g, $39.00/5g, $66.00/10g, $139.00/25g, $433.00/100g,

Product Details

[1-(2-Hydroxy-2-methyl-propyl)pyrazol-4-yl]boronic acid pinacol ester

1082503-77-2

$6.00/100mg, $7.00/250mg, $19.00/1g, $70.00/5g, $133.00/10g, $305.00/25g, $1,004.00/100g,

Product Details

Potassium cyclobutyltrifluoroborate

1065010-88-9

$11.00/100mg, $18.00/250mg, $44.00/1g, $208.00/5g, $390.00/10g, $866.00/25g,

Product Details

Micronomicin