
Catalog Number	AR00DPEP
Chemical Name	axillarin
CAS Number	5188-73-8
Molecular Formula	C17H14O8
Molecular Weight	346.2883
MDL Number	MFCD18450702
SMILES	COc1c(O)cc2c(c1O)c(=O)c(c(o2)c1ccc(c(c1)O)O)OC

2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one is a versatile compound utilized in chemical synthesis for its unique properties and reactivity. This molecule contains multiple functional groups, including hydroxyl and methoxy groups, which make it a valuable building block for various synthetic pathways.In organic synthesis, 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one can serve as a precursor for the synthesis of complex molecules with biological activity. The dihydroxyphenyl group can undergo selective chemical transformations to introduce specific functionalities at precise positions, allowing for the creation of structurally diverse compounds.Additionally, the presence of both hydroxyl and methoxy groups in the benzopyran moiety provides opportunities for regioselective modifications, enabling chemists to design and produce target molecules with desired properties. This compound's structural features make it a valuable tool for designing new pharmaceuticals, agrochemicals, and materials with tailored functions.