
Catalog Number	AR00E8P7
Chemical Name	2-(2,2-difluoro-2H-1,3-benzodioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS Number	517874-23-6
Molecular Formula	C13H15BF2O4
Molecular Weight	284.06360639999997
MDL Number	MFCD22414443
SMILES	FC1(F)Oc2c(O1)cc(cc2)B1OC(C(O1)(C)C)(C)C

2-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a versatile compound commonly used in chemical synthesis as a boron-containing reagent. It serves as a valuable building block in the formation of complex organic molecules, particularly in the field of medicinal chemistry and material science. The unique structure of this compound allows for selective reactions, making it a valuable tool for the synthesis of pharmaceutical intermediates, agrochemicals, and functional materials. When utilized in cross-coupling reactions, this compound can facilitate the formation of C–C and C–heteroatom bonds, enabling the construction of intricate molecular architectures with high efficiency and selectivity. Its strategic incorporation in synthetic pathways contributes to the rapid and efficient assembly of target molecules with precise control over regio- and stereoselectivity. By harnessing the reactivity of 2-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, chemists can expedite the synthesis of diverse organic compounds with enhanced structural complexity and functionality.