
Catalog Number	AR00DJR0
Chemical Name	N-METHYL-3-INDOLEGLYOXYLIC ACID 97
CAS Number	51584-18-0
Molecular Formula	C11H9NO3
Molecular Weight	203.1941
MDL Number	MFCD02683552
SMILES	OC(=O)C(=O)c1cn(c2c1cccc2)C

2-(1-Methyl-1H-indol-3-yl)-2-oxoacetic acid is a versatile compound that plays a crucial role in chemical synthesis processes. This compound is commonly used as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and organic compounds. Its unique chemical structure allows for efficient and selective functional group transformations, making it a valuable building block in the synthesis of complex organic molecules. By serving as a precursor in various chemical reactions, 2-(1-Methyl-1H-indol-3-yl)-2-oxoacetic acid enables chemists to create novel compounds with specific properties and functionalities. Its versatility and reactivity make it a valuable tool for researchers and synthetic chemists in the development of new drugs, materials, and other chemical products.