
Catalog Number	AR01KZRO
Chemical Name	5-bromo-N-cyclopropyl-2-fluoro-4-methylbenzamide
CAS Number	515135-64-5
Molecular Formula	C11H11BrFNO
Molecular Weight	272.1135
MDL Number	MFCD27924716
SMILES	O=C(c1cc(Br)c(cc1F)C)NC1CC1

5-Bromo-N-cyclopropyl-2-fluoro-4-methylbenzamide is a versatile compound widely utilized in chemical synthesis as a key building block for creating complex organic molecules. This compound serves as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals due to its unique structural properties and reactivity. Its cyclopropyl and fluoro substituents confer specific stereochemical and electronic attributes that are essential for controlling the course of various reactions. In organic synthesis, this compound plays a pivotal role in introducing structural diversity, enhancing biological activity, and enabling the production of novel molecules with tailored functionalities. Its application in chemical synthesis showcases its significance as a valuable tool for generating a wide range of molecular architectures with potential applications in drug discovery and material science.