
Catalog Number	AR01PX0V
Chemical Name	Furo[3,2-g]isoquinoline-2,9(7H,9aH)-dione, 9a-methyl-3-(1-oxohexyl)-6-(1E)-1-propen-1-yl-, (9aR)-
CAS Number	514-66-9
Molecular Formula	C21H23NO4
Molecular Weight	353.4116
SMILES	CCCCCC(=O)C1=C2C=C3C=C(/C=C/C)NC=C3C(=O)[C@@]2(OC1=O)C

Rubropunctamine is a versatile compound that finds widespread application in chemical synthesis, particularly in the field of organic chemistry. Due to its unique structural features and reactivity, Rubropunctamine serves as a valuable building block in the creation of complex molecules and the formation of novel chemical entities. In organic synthesis, Rubropunctamine can be utilized as a key intermediate for the construction of various heterocyclic frameworks, enabling the synthesis of diverse pharmaceuticals, agrochemicals, and materials with tailored properties. Its ability to undergo selective transformations and participate in key bond-forming reactions makes Rubropunctamine a sought-after reagent for the efficient assembly of intricate molecular structures. By incorporating Rubropunctamine into synthetic routes, chemists can access new pathways to functionalized compounds and advance the frontiers of chemical discovery and innovation.