
Catalog Number	AR00I9W3
Chemical Name	Benzene, 1-[(methylthio)methyl]-3-nitro-
CAS Number	51392-54-2
Molecular Formula	C8H9NO2S
Molecular Weight	183.2276
MDL Number	MFCD29059356
SMILES	CSCc1cccc(c1)[N+](=O)[O-]

The compound Benzene, 1-[(methylthio)methyl]-3-nitro- plays a crucial role in chemical synthesis as a versatile building block. Its unique structure allows for various synthetic pathways, making it a valuable intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. By incorporating this compound into reactions, chemists can access a wide range of derivatives with diverse functionalities, enhancing the development of novel and complex molecules. Additionally, the presence of both a nitro group and a thiomethyl group in this compound offers opportunities for further chemical modifications, opening up possibilities for tailored chemical synthesis strategies.