
Catalog Number	AR006X7Q
Chemical Name	[1,1'-Biphenyl]-4-aceticacid, 4'-hydroxy-
CAS Number	51350-23-3
Molecular Formula	C14H12O3
Molecular Weight	228.2433
MDL Number	MFCD11617144
SMILES	OC(=O)Cc1ccc(cc1)c1ccc(cc1)O

The [1,1'-Biphenyl]-4-acetic acid, 4'-hydroxy- is a crucial chemical reagent widely used in chemical synthesis processes. With its unique molecular structure and properties, it serves as a versatile building block in the creation of various organic compounds. This compound plays a significant role as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Known for its stability and reactivity, [1,1'-Biphenyl]-4-acetic acid, 4'-hydroxy- is often employed in the manufacturing of complex molecules through strategic bond formations and functional group manipulations. Its ability to undergo diverse chemical transformations makes it an indispensable tool for researchers and chemists working on the development of novel compounds with tailored properties and functionalities.