
Catalog Number	AR00DIW3
Chemical Name	Clanfenur
CAS Number	51213-99-1
Molecular Formula	C16H15ClFN3O2
Molecular Weight	335.7606
MDL Number	MFCD00868777
SMILES	O=C(NC(=O)c1c(F)cccc1N(C)C)Nc1ccc(cc1)Cl

5-Mercaptomethyluracil, also known as thiamethoxam, is a versatile compound widely used in chemical synthesis. Its primary application lies in its role as a key building block in the manufacturing of pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, 5-mercaptomethyluracil serves as a valuable precursor for the synthesis of various heterocyclic compounds. It can be utilized to introduce functional groups such as mercapto and methyl groups into organic molecules, enabling the creation of new compounds with diverse properties and applications. Furthermore, 5-mercaptomethyluracil exhibits unique reactivity due to the presence of its sulfur-containing mercapto group, making it a sought-after reagent in the development of novel chemical reactions and processes. Its versatility and compatibility with a wide range of synthetic methodologies make it an indispensable tool for chemists working in drug discovery, material science, and other fields requiring specialized organic building blocks.