
Catalog Number	AR006W9S
Chemical Name	(6-Carboxyhexyl)triphenylphosphonium bromide
CAS Number	50889-30-0
Molecular Formula	C25H28BrO2P
Molecular Weight	471.3664
MDL Number	MFCD28968081
SMILES	OC(=O)CCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]

(6-Carboxyhexyl)triphenylphosphonium bromide is a versatile chemical compound widely used in chemical synthesis processes. This compound serves as an efficient and selective reagent in various reactions due to its unique properties. Its primary application lies in the synthesis of organic molecules and pharmaceutical intermediates.In chemical synthesis, (6-Carboxyhexyl)triphenylphosphonium bromide acts as a strong nucleophile, allowing it to participate in nucleophilic substitution reactions. It can react with various electrophiles to form new carbon-carbon or carbon-heteroatom bonds. This reactivity makes it valuable in the construction of complex organic structures.Furthermore, the presence of the carboxylic acid moiety in this compound provides additional versatility in synthetic transformations. It can undergo esterification or amidation reactions to introduce specific functional groups into the target molecules, allowing for further modification and derivatization.Overall, (6-Carboxyhexyl)triphenylphosphonium bromide plays a crucial role in modern chemical synthesis by enabling the efficient and controlled formation of key bonds in the production of fine chemicals, pharmaceuticals, and advanced materials. Its unique reactivity and functional group compatibility make it a valuable tool for synthetic chemists seeking to tailor molecules with precision.