
Catalog Number	AR003B9U
Chemical Name	2-Cyclohexyl-2-(4-hydroxycyclohexyl)propane
CAS Number	50807-15-3
Molecular Formula	C15H28O
Molecular Weight	224.3822200000001
MDL Number	MFCD18969438
SMILES	OC1CCC(CC1)C(C1CCCCC1)(C)C

2-Cyclohexyl-2-(4-hydroxycyclohexyl)propane, commonly referred to as $name$, is a versatile compound extensively utilized in chemical synthesis. With its unique structure and reactivity, this compound serves as a valuable building block in the creation of diverse organic molecules. One of the key applications of 2-Cyclohexyl-2-(4-hydroxycyclohexyl)propane in chemical synthesis is as a precursor in the synthesis of complex pharmaceutical compounds due to its ability to introduce specific functional groups with precision. Additionally, this compound is employed in the development of specialty polymers, where its structural features contribute to the desired properties of the final material. In the realm of organic chemistry research, 2-Cyclohexyl-2-(4-hydroxycyclohexyl)propane plays a pivotal role in the design and construction of intricate molecular structures, enabling scientists to explore new avenues in synthetic methodology and materials science.