
Catalog Number	AR006WU6
Chemical Name	FMOC-(S)-3-AMINO-3-(2-TRIFLUOROMETHYL-PHENYL)-PROPIONIC ACID
CAS Number	507472-19-7
Molecular Formula	C25H20F3NO4
Molecular Weight	455.4258
MDL Number	MFCD03428001
SMILES	OC(=O)C[C@@H](c1ccccc1C(F)(F)F)NC(=O)OCC1c2ccccc2c2c1cccc2

The (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid, also known as $name$, is a valuable compound widely utilized in chemical synthesis processes. This specific compound serves as a versatile building block in the creation of various pharmaceuticals and other complex organic molecules. Its unique structural properties make it ideal for introducing specific functional groups and stereochemistry into target molecules during synthetic processes. With its strategic placement within a synthetic pathway, (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid plays a crucial role in the efficient and precise construction of intricate molecular structures.