
Catalog Number	AR01OIJR
Chemical Name	Carbamic acid, N-[trans-4-[2-[4-(2,3-dichlorophenyl)-1-piperazinyl]ethyl]cyclohexyl]-, 1,1-dimethylethyl ester
CAS Number	506427-91-4
Molecular Formula	C23H35Cl2N3O2
Molecular Weight	456.4489
MDL Number	MFCD28386599
SMILES	O=C(OC(C)(C)C)N[C@@H]1CC[C@H](CC1)CCN1CCN(CC1)c1cccc(c1Cl)Cl

1,1-Dimethylethyl N-[trans-4-[2-[4-(2,3-dichlorophenyl)-1-piperazinyl]ethyl]cyclohexyl]carbamate is a compound frequently utilized in chemical synthesis due to its versatile nature and unique structural properties. This compound is commonly employed as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its specific arrangement of functional groups allows for the introduction of diverse chemical moieties, enabling the creation of complex molecular structures. In organic synthesis, this compound serves as a crucial intermediate for the production of novel compounds with potential biological activities. Its strategic placement within a synthetic route facilitates the efficient construction of target molecules with enhanced pharmacological or pesticidal properties.