
Catalog Number	AR00DBEM
Chemical Name	6-CHLORO-2,3,4,9-TETRAHYDRO-1H-CARBAZOLE-1-CARBOXYLIC ACID
CAS Number	50639-66-2
Molecular Formula	C13H12ClNO2
Molecular Weight	249.6929
MDL Number	MFCD01819788
SMILES	OC(=O)C1CCCc2c1[nH]c1c2cc(cc1)Cl

6-Chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid is a valuable building block in chemical synthesis. As a versatile intermediate, it plays a crucial role in the preparation of various pharmaceuticals, agrochemicals, and functional materials. This compound serves as a key starting material for the synthesis of carbazole derivatives, which exhibit diverse biological activities and are commonly found in drugs and natural products. Additionally, its structural features make it a useful precursor for the construction of heterocyclic compounds, which are widely utilized in medicinal chemistry and materials science.