
Catalog Number	AR019QM1
Chemical Name	4-(pyridin-2-ylmethoxy)benzoic acid
CAS Number	50596-36-6
Molecular Formula	C13H11NO3
Molecular Weight	229.2313
MDL Number	MFCD08098737
SMILES	OC(=O)c1ccc(cc1)OCc1ccccn1

4-(Pyridin-2-ylmethoxy)benzoic acid is a versatile compound commonly used in chemical synthesis as a building block for the creation of various organic molecules. Due to its unique structure, this compound serves as a valuable intermediate in the production of pharmaceuticals, agrochemicals, and materials with specialized properties. Its ability to undergo diverse chemical reactions makes it a valuable tool in the synthesis of complex organic compounds. This compound plays a crucial role in the development of new materials and substances with specific applications in the fields of medicine, agriculture, and materials science. Its synthesis and subsequent utilization highlight the importance of organic chemistry in providing innovative solutions for a wide range of industries.