
Catalog Number	AR01BZ0V
Chemical Name	2,2-Difluoro-1-[3-(trifluoromethyl)phenyl]-ethanone
CAS Number	50562-07-7
Molecular Formula	C9H5F5O
Molecular Weight	224.1274
MDL Number	MFCD12828047
SMILES	FC(C(=O)c1cccc(c1)C(F)(F)F)F

2,2-Difluoro-1-[3-(trifluoromethyl)phenyl]ethanone is a versatile compound that finds wide applications in chemical synthesis. This compound is particularly valued for its role as a key building block in the development of pharmaceuticals and agrochemicals. Its unique structure and properties make it a valuable intermediate in the synthesis of a variety of complex organic molecules.In chemical synthesis, 2,2-Difluoro-1-[3-(trifluoromethyl)phenyl]ethanone serves as a valuable starting material in the creation of fluorinated compounds, which are known for their distinct properties and wide-ranging applications. The difluoro and trifluoromethyl groups present in this compound can be strategically utilized to introduce fluorine atoms into target molecules, thereby enhancing their bioactivity, metabolic stability, and overall performance.Furthermore, the trifluoromethylphenyl moiety in 2,2-Difluoro-1-[3-(trifluoromethyl)phenyl]ethanone imparts unique chemical reactivity, allowing for selective functionalization and derivatization in organic synthesis. This compound can be employed in various reactions, such as nucleophilic substitution, cross-coupling, and metal-catalyzed transformations, to introduce diverse functional groups and structural motifs into organic molecules.Overall, the strategic placement of fluorine and trifluoromethyl groups in 2,2-Difluoro-1-[3-(trifluoromethyl)phenyl]ethanone makes it a valuable tool in the hands of synthetic chemists for the construction of complex molecules with tailored properties and enhanced performance in pharmaceutical and agrochemical applications.