
Catalog Number	AR00DF7W
Chemical Name	2-OXAZOLIDINONE-5-SPIRO-4'-[N-(2-PHENYLETHYL)PIPERIDINE] HYDROCHLORIDE
CAS Number	5053-08-7
Molecular Formula	C15H21ClN2O2
Molecular Weight	296.7924
MDL Number	MFCD00133315
SMILES	O=C1NCC2(O1)CCN(CC2)CCc1ccccc1.Cl
NSC Number	757825

Fenspiride hydrochloride, a pharmaceutical compound used primarily as a bronchodilator and anti-inflammatory agent, also finds application in chemical synthesis. In organic chemistry, Fenspiride hydrochloride can be utilized as a reagent or catalyst in various transformations such as oxidation, reduction, and alkylation reactions. Its unique structural properties make it a versatile molecule for creating new chemical entities and functionalized compounds. Additionally, Fenspiride hydrochloride can serve as a building block in the synthesis of more complex drug molecules or intermediates through its ability to participate in key bond forming processes. Its role in chemical synthesis underscores its significance not only in the pharmaceutical industry but also in the broader field of synthetic chemistry.