
Catalog Number	AR00DIUA
Chemical Name	2-(4-Nitrophenyl)acetyl chloride
CAS Number	50434-36-1
Molecular Formula	C8H6ClNO3
Molecular Weight	199.5911
MDL Number	MFCD00130224
SMILES	ClC(=O)Cc1ccc(cc1)[N+](=O)[O-]

Benzeneacetylchloride, 4-nitro- is a valuable chemical reagent commonly used in organic synthesis processes. It plays a crucial role as an acylating agent in various chemical reactions, particularly in the creation of pharmaceutical intermediates and agrochemicals. With its unique properties, Benzeneacetylchloride, 4-nitro- serves as a versatile building block for the manufacture of a wide range of compounds. Its reactivity and selectivity in acylation reactions make it an essential component in the synthesis of complex organic molecules with specific functionalities.