
Catalog Number	AR003ALW
Chemical Name	(2E,6Z,8E,10E)-N-(2-Methylpropyl)-2,6,8,10-dodecatetraenamide
CAS Number	504-97-2
Molecular Formula	C16H25NO
Molecular Weight	247.3758
MDL Number	MFCD22380929
SMILES	C/C=C/C=C/C=C\CC/C=C/C(=O)NCC(C)C

In chemical synthesis, (2E,6Z,8E,10E)-N-(2-Methylpropyl)-2,6,8,10-dodecatetraenamide, also known as $name$, serves as a versatile building block for the creation of various organic compounds. Due to its unique structure and functional groups, this compound is commonly employed in the formation of complex molecules through the manipulation of its double bonds and amide functionality. Its presence can facilitate the synthesis of diverse chemical entities with potentially valuable properties, making it a valuable tool for organic chemists seeking to design and produce novel compounds for a range of applications.