
Catalog Number	AR00I9QH
Chemical Name	8-Azabicyclo[3.2.1]octane-2-carboxylic acid,3-(4-fluorophenyl)-8-methyl-, methyl ester, (1R,2S,3S,5S)-
CAS Number	50370-56-4
Molecular Formula	C16H20FNO2
Molecular Weight	277.3339
MDL Number	MFCD02683994
SMILES	COC(=O)[C@@H]1[C@H]2CC[C@H](N2C)C[C@@H]1c1ccc(cc1)F

Win 35428, also known as 2-carbomethoxytroparil, is a chemical compound commonly used in chemical synthesis for its unique properties and applications. This compound is particularly valued in the field of medicinal chemistry due to its potential as a dopamine reuptake inhibitor, making it a promising candidate for the development of drugs targeting conditions such as Parkinson's disease and addiction. In addition, Win 35428 has shown significant potential in the synthesis of novel psychoactive compounds and other pharmaceutical agents. Its versatile nature and distinct chemical structure make it a valuable tool for researchers and chemists seeking to explore new avenues in drug discovery and development.