
Catalog Number	AR00DM8P
Chemical Name	1-benzyl-2-tert-butyl-4-oxopyrazolidine-1,2-dicarboxylate
CAS Number	503072-63-7
Molecular Formula	C16H20N2O5
Molecular Weight	320.3404
MDL Number	MFCD21648521
SMILES	O=C1CN(N(C1)C(=O)OC(C)(C)C)C(=O)OCc1ccccc1

1-Benzyl 2-tert-butyl 4-oxopyrazolidine-1,2-dicarboxylate, a versatile compound in chemical synthesis, serves as a valuable building block in organic chemistry. Its unique structure and functional groups make it a pivotal intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. In the realm of chemical synthesis, this compound is known for its ability to undergo diverse transformations, including amidation, esterification, and hydrogenation reactions. Its presence in the synthetic toolbox allows for the efficient construction of intricate molecular structures, enabling chemists to access a wide range of novel compounds with potential therapeutic or industrial applications.